C31H46F3N7O6 — CID 166980308
(2S)-2-[6-[[(2S)-2-acetamido-6-azidohexanoyl]amino]hexanoylamino]-6-[4-[4-(trifluoromethyl)phenyl]butanoylamino]hexanoic acid (PubChem CID 166980308) has the molecular formula C31H46F3N7O6 and a molecular weight of 669.75 g/mol. Its IUPAC name is (2S)-2-[6-[[(2S)-2-acetamido-6-azidohexanoyl]amino]hexanoylamino]-6-[4-[4-(trifluoromethyl)phenyl]butanoylamino]hexanoic acid.
| Compound Name | (2S)-2-[6-[[(2S)-2-acetamido-6-azidohexanoyl]amino]hexanoylamino]-6-[4-[4-(trifluoromethyl)phenyl]butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 166980308 |
| Molecular Formula | C31H46F3N7O6 |
| Molecular Weight | 669.75 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | (2S)-2-[6-[[(2S)-2-acetamido-6-azidohexanoyl]amino]hexanoylamino]-6-[4-[4-(trifluoromethyl)phenyl]butanoylamino]hexanoic acid |
| SMILES | CC(=O)N[C@@H](CCCCN=[N+]=[N-])C(=O)NCCCCCC(=O)N[C@@H](CCCCNC(=O)CCCc1ccc(C(F)(F)F)cc1)C(=O)O |
| InChI | InChI=1S/C31H46F3N7O6/c1-22(42)39-25(11-5-8-21-38-41-35)29(45)37-20-6-2-3-13-28(44)40-26(30(46)47)12-4-7-19-36-27(43)14-9-10-23-15-17-24(18-16-23)31(32,33)34/h15-18,25-26H,2-14,19-21H2,1H3,(H,36,43)(H,37,45)(H,39,42)(H,40,44)(H,46,47)/t25-,26-/m0/s1 |
| InChIKey | PQSOIJDEJOVYTH-UIOOFZCWSA-N |
| XLogP | 4.55 |
| TPSA | 202.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|