C28H42N8O8 — CID 89418136
(2S)-6-[[4-[(4-azidobenzoyl)amino]-7-(5-carboxypentylamino)-7-oxoheptanoyl]amino]-2-(methylcarbamoylamino)hexanoic acid (PubChem CID 89418136) has the molecular formula C28H42N8O8 and a molecular weight of 618.69 g/mol. Its IUPAC name is (2S)-6-[[4-[(4-azidobenzoyl)amino]-7-(5-carboxypentylamino)-7-oxoheptanoyl]amino]-2-(methylcarbamoylamino)hexanoic acid.
| Compound Name | (2S)-6-[[4-[(4-azidobenzoyl)amino]-7-(5-carboxypentylamino)-7-oxoheptanoyl]amino]-2-(methylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 89418136 |
| Molecular Formula | C28H42N8O8 |
| Molecular Weight | 618.69 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | (2S)-6-[[4-[(4-azidobenzoyl)amino]-7-(5-carboxypentylamino)-7-oxoheptanoyl]amino]-2-(methylcarbamoylamino)hexanoic acid |
| SMILES | CNC(=O)N[C@@H](CCCCNC(=O)CCC(CCC(=O)NCCCCCC(=O)O)NC(=O)c1ccc(N=[N+]=[N-])cc1)C(=O)O |
| InChI | InChI=1S/C28H42N8O8/c1-30-28(44)34-22(27(42)43)7-4-6-18-32-24(38)16-14-20(13-15-23(37)31-17-5-2-3-8-25(39)40)33-26(41)19-9-11-21(12-10-19)35-36-29/h9-12,20,22H,2-8,13-18H2,1H3,(H,31,37)(H,32,38)(H,33,41)(H,39,40)(H,42,43)(H2,30,34,44)/t20?,22-/m0/s1 |
| InChIKey | FVPYHNXSUZCXQH-IAXKEJLGSA-N |
| XLogP | 2.72 |
| TPSA | 251.79 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.69 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|