C14H21BrN4O — CID 133373725
1-[4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-2-(dimethylamino)ethanone (PubChem CID 133373725) has the molecular formula C14H21BrN4O and a molecular weight of 341.25 g/mol. Its IUPAC name is 1-[4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-2-(dimethylamino)ethanone.
| Compound Name | 1-[4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 133373725 |
| Molecular Formula | C14H21BrN4O |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-[4-(5-bromo-3-methyl-2-pyridinyl)piperazin-1-yl]-2-(dimethylamino)ethanone |
| SMILES | Cc1cc(Br)cnc1N1CCN(C(=O)CN(C)C)CC1 |
| InChI | InChI=1S/C14H21BrN4O/c1-11-8-12(15)9-16-14(11)19-6-4-18(5-7-19)13(20)10-17(2)3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | BVVVKQSIPXVTMR-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |