C25H31N5O3 — CID 134495156
(5S)-5-propyl-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 134495156) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (5S)-5-propyl-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-propyl-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134495156 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (5S)-5-propyl-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | CCC[C@@]1(c2ccc(C(=O)N3CCN(c4nc(C)c(C)cc4C)CC3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C25H31N5O3/c1-5-10-25(23(32)27-24(33)28-25)20-8-6-19(7-9-20)22(31)30-13-11-29(12-14-30)21-17(3)15-16(2)18(4)26-21/h6-9,15H,5,10-14H2,1-4H3,(H2,27,28,32,33)/t25-/m0/s1 |
| InChIKey | GYMUJJHMEJGNLA-VWLOTQADSA-N |
| XLogP | 2.80 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|