C25H30N4O3 — CID 134494693
3-ethyl-3-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,4-dione (PubChem CID 134494693) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 3-ethyl-3-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,4-dione.
| Compound Name | 3-ethyl-3-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 134494693 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-ethyl-3-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]pyrrolidine-2,4-dione |
| SMILES | CCC1(c2ccc(C(=O)N3CCN(c4nc(C)c(C)cc4C)CC3)cc2)C(=O)CNC1=O |
| InChI | InChI=1S/C25H30N4O3/c1-5-25(21(30)15-26-24(25)32)20-8-6-19(7-9-20)23(31)29-12-10-28(11-13-29)22-17(3)14-16(2)18(4)27-22/h6-9,14H,5,10-13,15H2,1-4H3,(H,26,32) |
| InChIKey | MJKZSXCTBABAFR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|