C24H29N5O4 — CID 134494521
5-(methoxymethyl)-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione (PubChem CID 134494521) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 5-(methoxymethyl)-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-(methoxymethyl)-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 134494521 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 5-(methoxymethyl)-5-[4-[4-(3,5,6-trimethyl-2-pyridinyl)piperazine-1-carbonyl]phenyl]imidazolidine-2,4-dione |
| SMILES | COCC1(c2ccc(C(=O)N3CCN(c4nc(C)c(C)cc4C)CC3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C24H29N5O4/c1-15-13-16(2)20(25-17(15)3)28-9-11-29(12-10-28)21(30)18-5-7-19(8-6-18)24(14-33-4)22(31)26-23(32)27-24/h5-8,13H,9-12,14H2,1-4H3,(H2,26,27,31,32) |
| InChIKey | BXFCUPWLGHWDFO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|