About (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone
(2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone (PubChem CID 42380756) has the molecular formula C21H19FN2O2
and a molecular weight of 350.39 g/mol. Its IUPAC name is (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone.
Molecular Properties
| Compound Name | (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone |
| PubChem CID | 42380756 |
| Molecular Formula | C21H19FN2O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc2nc(C3CC3)oc2c1)N1CC[C@H](c2ccccc2F)C1 |
| InChI | InChI=1S/C21H19FN2O2/c22-17-4-2-1-3-16(17)15-9-10-24(12-15)21(25)14-7-8-18-19(11-14)26-20(23-18)13-5-6-13/h1-4,7-8,11,13,15H,5-6,9-10,12H2/t15-/m0/s1 |
| InChIKey | NOEOVZDMPTZVMD-HNNXBMFYSA-N |
| XLogP | 4.47 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone?
The IUPAC name of (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone (CID 42380756) is (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone.
What is the SMILES notation for (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone?
The canonical SMILES for (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone is O=C(c1ccc2nc(C3CC3)oc2c1)N1CC[C@H](c2ccccc2F)C1.
What is the InChIKey of (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone?
The InChIKey is NOEOVZDMPTZVMD-HNNXBMFYSA-N. The full InChI is InChI=1S/C21H19FN2O2/c22-17-4-2-1-3-16(17)15-9-10-24(12-15)21(25)14-7-8-18-19(11-14)26-20(23-18)13-5-6-13/h1-4,7-8,11,13,15H,5-6,9-10,12H2/t15-/m0/s1.
What are the key properties of (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone?
(2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone has a molecular weight of 350.39 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclopropyl-1,3-benzoxazol-6-yl)-[(3R)-3-(2-fluorophenyl)pyrrolidin-1-yl]methanone is sourced from PubChem (CID 42380756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).