C22H19ClN4O3 — CID 154863979
5-[3-(7-chloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbonyl)phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 154863979) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is 5-[3-(7-chloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbonyl)phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[3-(7-chloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbonyl)phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 154863979 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 5-[3-(7-chloro-3,4-dihydro-1H-pyrazino[1,2-a]indole-2-carbonyl)phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2cccc(C(=O)N3CCn4c(cc5ccc(Cl)cc54)C3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C22H19ClN4O3/c1-22(20(29)24-21(30)25-22)15-4-2-3-14(9-15)19(28)26-7-8-27-17(12-26)10-13-5-6-16(23)11-18(13)27/h2-6,9-11H,7-8,12H2,1H3,(H2,24,25,29,30) |
| InChIKey | ZLVKMDBWQZXZQS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|