C24H25N5O3S — CID 166182755
3-(1,3-benzothiazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 166182755) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 166182755 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | CC1(c2cccc(CNC(=O)N3CCCC(c4nc5ccccc5s4)C3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C24H25N5O3S/c1-24(21(30)27-22(31)28-24)17-8-4-6-15(12-17)13-25-23(32)29-11-5-7-16(14-29)20-26-18-9-2-3-10-19(18)33-20/h2-4,6,8-10,12,16H,5,7,11,13-14H2,1H3,(H,25,32)(H2,27,28,30,31) |
| InChIKey | SPXMQUCKUJIQGH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|