C19H21N3O3 — CID 97021835
3,3-dicyclopropyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]prop-2-enamide (PubChem CID 97021835) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 3,3-dicyclopropyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]prop-2-enamide.
| Compound Name | 3,3-dicyclopropyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 97021835 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3,3-dicyclopropyl-N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]prop-2-enamide |
| SMILES | C[C@@]1(c2cccc(NC(=O)C=C(C3CC3)C3CC3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H21N3O3/c1-19(17(24)21-18(25)22-19)13-3-2-4-14(9-13)20-16(23)10-15(11-5-6-11)12-7-8-12/h2-4,9-12H,5-8H2,1H3,(H,20,23)(H2,21,22,24,25)/t19-/m0/s1 |
| InChIKey | NDVDVGHJKYXKEX-IBGZPJMESA-N |
| XLogP | 2.43 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|