C17H22N4O3 — CID 119728478
3-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]cyclohexane-1-carboxamide (PubChem CID 119728478) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119728478 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-amino-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC1(c2cccc(NC(=O)C3CCCC(N)C3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C17H22N4O3/c1-17(15(23)20-16(24)21-17)11-5-3-7-13(9-11)19-14(22)10-4-2-6-12(18)8-10/h3,5,7,9-10,12H,2,4,6,8,18H2,1H3,(H,19,22)(H2,20,21,23,24) |
| InChIKey | QYTIUCJGJMQFMI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|