C21H28N4O4 — CID 51949323
1-(2,2-dimethylpropanoyl)-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]piperidine-4-carboxamide (PubChem CID 51949323) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 1-(2,2-dimethylpropanoyl)-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2,2-dimethylpropanoyl)-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 51949323 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 1-(2,2-dimethylpropanoyl)-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]piperidine-4-carboxamide |
| SMILES | CC(C)(C)C(=O)N1CCC(C(=O)Nc2cccc([C@@]3(C)NC(=O)NC3=O)c2)CC1 |
| InChI | InChI=1S/C21H28N4O4/c1-20(2,3)18(28)25-10-8-13(9-11-25)16(26)22-15-7-5-6-14(12-15)21(4)17(27)23-19(29)24-21/h5-7,12-13H,8-11H2,1-4H3,(H,22,26)(H2,23,24,27,29)/t21-/m1/s1 |
| InChIKey | CFUHFICTUSCTAM-OAQYLSRUSA-N |
| XLogP | 1.96 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|