C17H27N3O3S — CID 119688782
3-amino-N-[3-(tert-butylsulfamoyl)phenyl]cyclohexane-1-carboxamide (PubChem CID 119688782) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 3-amino-N-[3-(tert-butylsulfamoyl)phenyl]cyclohexane-1-carboxamide.
| Compound Name | 3-amino-N-[3-(tert-butylsulfamoyl)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119688782 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 3-amino-N-[3-(tert-butylsulfamoyl)phenyl]cyclohexane-1-carboxamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)C2CCCC(N)C2)c1 |
| InChI | InChI=1S/C17H27N3O3S/c1-17(2,3)20-24(22,23)15-9-5-8-14(11-15)19-16(21)12-6-4-7-13(18)10-12/h5,8-9,11-13,20H,4,6-7,10,18H2,1-3H3,(H,19,21) |
| InChIKey | CCRMCYHOSOCODH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |