C21H33N3O5S — CID 55438893
tert-butyl 3-[[3-(tert-butylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 55438893) has the molecular formula C21H33N3O5S and a molecular weight of 439.58 g/mol. Its IUPAC name is tert-butyl 3-[[3-(tert-butylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-(tert-butylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55438893 |
| Molecular Formula | C21H33N3O5S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | tert-butyl 3-[[3-(tert-butylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(NC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)c1 |
| InChI | InChI=1S/C21H33N3O5S/c1-20(2,3)23-30(27,28)17-11-7-10-16(13-17)22-18(25)15-9-8-12-24(14-15)19(26)29-21(4,5)6/h7,10-11,13,15,23H,8-9,12,14H2,1-6H3,(H,22,25) |
| InChIKey | LMVRLEVGNLJTHO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |