C22H29N3O6S — CID 55439389
tert-butyl 3-[[3-(furan-2-ylmethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 55439389) has the molecular formula C22H29N3O6S and a molecular weight of 463.56 g/mol. Its IUPAC name is tert-butyl 3-[[3-(furan-2-ylmethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-(furan-2-ylmethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 55439389 |
| Molecular Formula | C22H29N3O6S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | tert-butyl 3-[[3-(furan-2-ylmethylsulfamoyl)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)Nc2cccc(S(=O)(=O)NCc3ccco3)c2)C1 |
| InChI | InChI=1S/C22H29N3O6S/c1-22(2,3)31-21(27)25-11-5-7-16(15-25)20(26)24-17-8-4-10-19(13-17)32(28,29)23-14-18-9-6-12-30-18/h4,6,8-10,12-13,16,23H,5,7,11,14-15H2,1-3H3,(H,24,26) |
| InChIKey | GTTBDDGMKZOVTQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |