C16H13BrN4O3 — CID 51949297
5-bromo-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-3-carboxamide (PubChem CID 51949297) has the molecular formula C16H13BrN4O3 and a molecular weight of 389.21 g/mol. Its IUPAC name is 5-bromo-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-3-carboxamide.
| Compound Name | 5-bromo-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 51949297 |
| Molecular Formula | C16H13BrN4O3 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 5-bromo-N-[3-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]pyridine-3-carboxamide |
| SMILES | C[C@]1(c2cccc(NC(=O)c3cncc(Br)c3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H13BrN4O3/c1-16(14(23)20-15(24)21-16)10-3-2-4-12(6-10)19-13(22)9-5-11(17)8-18-7-9/h2-8H,1H3,(H,19,22)(H2,20,21,23,24)/t16-/m1/s1 |
| InChIKey | WJKVYNBXCFPYIQ-MRXNPFEDSA-N |
| XLogP | 2.15 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|