C23H22F3N3O3 — CID 55811816
N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 55811816) has the molecular formula C23H22F3N3O3 and a molecular weight of 445.44 g/mol. Its IUPAC name is N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 55811816 |
| Molecular Formula | C23H22F3N3O3 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-[3-(trifluoromethyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | CC1(c2cccc(NC(=O)C3(c4cccc(C(F)(F)F)c4)CCCC3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C23H22F3N3O3/c1-21(18(30)28-20(32)29-21)14-6-5-9-17(13-14)27-19(31)22(10-2-3-11-22)15-7-4-8-16(12-15)23(24,25)26/h4-9,12-13H,2-3,10-11H2,1H3,(H,27,31)(H2,28,29,30,32) |
| InChIKey | RTHFCMHECCYEPR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|