C17H18F3NO2 — CID 98137589
(1R,4S)-3,3-dimethyl-2-oxo-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98137589) has the molecular formula C17H18F3NO2 and a molecular weight of 325.33 g/mol. Its IUPAC name is (1R,4S)-3,3-dimethyl-2-oxo-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4S)-3,3-dimethyl-2-oxo-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98137589 |
| Molecular Formula | C17H18F3NO2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | (1R,4S)-3,3-dimethyl-2-oxo-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)C(=O)[C@@]2(C(=O)Nc3cccc(C(F)(F)F)c3)CC[C@H]1C2 |
| InChI | InChI=1S/C17H18F3NO2/c1-15(2)11-6-7-16(9-11,13(15)22)14(23)21-12-5-3-4-10(8-12)17(18,19)20/h3-5,8,11H,6-7,9H2,1-2H3,(H,21,23)/t11-,16+/m0/s1 |
| InChIKey | HYKBGASCLFWFJV-MEDUHNTESA-N |
| XLogP | 4.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|