C18H20F3NO — CID 2972478
3,3-dimethyl-2-methylidene-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 2972478) has the molecular formula C18H20F3NO and a molecular weight of 323.36 g/mol. Its IUPAC name is 3,3-dimethyl-2-methylidene-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 3,3-dimethyl-2-methylidene-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 2972478 |
| Molecular Formula | C18H20F3NO |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3,3-dimethyl-2-methylidene-N-[3-(trifluoromethyl)phenyl]bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C2(C(=O)Nc3cccc(C(F)(F)F)c3)CCC(C2)C1(C)C |
| InChI | InChI=1S/C18H20F3NO/c1-11-16(2,3)13-7-8-17(11,10-13)15(23)22-14-6-4-5-12(9-14)18(19,20)21/h4-6,9,13H,1,7-8,10H2,2-3H3,(H,22,23) |
| InChIKey | JEQNRICCZJTQDS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|