C17H18F3NO — CID 98525297
(1S,2S,5R,6S)-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]tricyclo[3.2.0.02,6]heptane-1-carboxamide (PubChem CID 98525297) has the molecular formula C17H18F3NO and a molecular weight of 309.33 g/mol. Its IUPAC name is (1S,2S,5R,6S)-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]tricyclo[3.2.0.02,6]heptane-1-carboxamide.
| Compound Name | (1S,2S,5R,6S)-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]tricyclo[3.2.0.02,6]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98525297 |
| Molecular Formula | C17H18F3NO |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (1S,2S,5R,6S)-2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]tricyclo[3.2.0.02,6]heptane-1-carboxamide |
| SMILES | C[C@]12CC[C@@H]3[C@]1(C)C[C@]32C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3NO/c1-14-9-16(12(14)6-7-15(14,16)2)13(22)21-11-5-3-4-10(8-11)17(18,19)20/h3-5,8,12H,6-7,9H2,1-2H3,(H,21,22)/t12-,14+,15+,16-/m1/s1 |
| InChIKey | QUGPFRCQTQGUTC-SYAUCNOPSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |