C17H12Cl2F3NO — CID 2832397
2,2-dichloro-1-phenyl-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 2832397) has the molecular formula C17H12Cl2F3NO and a molecular weight of 374.19 g/mol. Its IUPAC name is 2,2-dichloro-1-phenyl-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-phenyl-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2832397 |
| Molecular Formula | C17H12Cl2F3NO |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 2,2-dichloro-1-phenyl-N-[3-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C17H12Cl2F3NO/c18-16(19)10-15(16,11-5-2-1-3-6-11)14(24)23-13-8-4-7-12(9-13)17(20,21)22/h1-9H,10H2,(H,23,24) |
| InChIKey | PTEJXOSDLFWBEK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|