C16H11Cl4NO — CID 7039242
(1S)-2,2-dichloro-N-(3,4-dichlorophenyl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 7039242) has the molecular formula C16H11Cl4NO and a molecular weight of 375.08 g/mol. Its IUPAC name is (1S)-2,2-dichloro-N-(3,4-dichlorophenyl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dichloro-N-(3,4-dichlorophenyl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 7039242 |
| Molecular Formula | C16H11Cl4NO |
| Molecular Weight | 375.08 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | (1S)-2,2-dichloro-N-(3,4-dichlorophenyl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)[C@@]1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H11Cl4NO/c17-12-7-6-11(8-13(12)18)21-14(22)15(9-16(15,19)20)10-4-2-1-3-5-10/h1-8H,9H2,(H,21,22)/t15-/m0/s1 |
| InChIKey | BDIBKHXOXFNHIZ-HNNXBMFYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.08 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|