C13H8Cl2F3N3OS — CID 139914678
2,2-dichloro-1-phenyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 139914678) has the molecular formula C13H8Cl2F3N3OS and a molecular weight of 382.19 g/mol. Its IUPAC name is 2,2-dichloro-1-phenyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-1-phenyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139914678 |
| Molecular Formula | C13H8Cl2F3N3OS |
| Molecular Weight | 382.19 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 2,2-dichloro-1-phenyl-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1nnc(C(F)(F)F)s1)C1(c2ccccc2)CC1(Cl)Cl |
| InChI | InChI=1S/C13H8Cl2F3N3OS/c14-12(15)6-11(12,7-4-2-1-3-5-7)8(22)19-10-21-20-9(23-10)13(16,17)18/h1-5H,6H2,(H,19,21,22) |
| InChIKey | CKBMOFXPJDTBLN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|