C20H20N4O2 — CID 111412039
1-[[2-(hydroxymethyl)phenyl]methyl]-3-[4-(4-methylpyrimidin-2-yl)phenyl]urea (PubChem CID 111412039) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 1-[[2-(hydroxymethyl)phenyl]methyl]-3-[4-(4-methylpyrimidin-2-yl)phenyl]urea.
| Compound Name | 1-[[2-(hydroxymethyl)phenyl]methyl]-3-[4-(4-methylpyrimidin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 111412039 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[[2-(hydroxymethyl)phenyl]methyl]-3-[4-(4-methylpyrimidin-2-yl)phenyl]urea |
| SMILES | Cc1ccnc(-c2ccc(NC(=O)NCc3ccccc3CO)cc2)n1 |
| InChI | InChI=1S/C20H20N4O2/c1-14-10-11-21-19(23-14)15-6-8-18(9-7-15)24-20(26)22-12-16-4-2-3-5-17(16)13-25/h2-11,25H,12-13H2,1H3,(H2,22,24,26) |
| InChIKey | ZKMKYFIOISYRCY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |