C21H18N4O3S — CID 55723008
4-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 55723008) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is 4-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55723008 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-methyl-N-[3-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)Nc1cccc(C2(C)NC(=O)NC2=O)c1 |
| InChI | InChI=1S/C21H18N4O3S/c1-12-16(29-18(22-12)13-7-4-3-5-8-13)17(26)23-15-10-6-9-14(11-15)21(2)19(27)24-20(28)25-21/h3-11H,1-2H3,(H,23,26)(H2,24,25,27,28) |
| InChIKey | RHKAAPATRBERIG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|