C21H19N5O4 — CID 166221820
N'-(1H-indol-7-yl)-N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]oxamide (PubChem CID 166221820) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is N'-(1H-indol-7-yl)-N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]oxamide.
| Compound Name | N'-(1H-indol-7-yl)-N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]oxamide |
|---|---|
| PubChem CID | 166221820 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N'-(1H-indol-7-yl)-N-[[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]methyl]oxamide |
| SMILES | CC1(c2ccc(CNC(=O)C(=O)Nc3cccc4cc[nH]c34)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C21H19N5O4/c1-21(19(29)25-20(30)26-21)14-7-5-12(6-8-14)11-23-17(27)18(28)24-15-4-2-3-13-9-10-22-16(13)15/h2-10,22H,11H2,1H3,(H,23,27)(H,24,28)(H2,25,26,29,30) |
| InChIKey | NUJLEEKXPXKUEC-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|