C19H15N3O4 — CID 75403122
N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 75403122) has the molecular formula C19H15N3O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 75403122 |
| Molecular Formula | C19H15N3O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[4-(4-methyl-2,5-dioxoimidazolidin-4-yl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | CC1(c2ccc(NC(=O)c3cc4ccccc4o3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H15N3O4/c1-19(17(24)21-18(25)22-19)12-6-8-13(9-7-12)20-16(23)15-10-11-4-2-3-5-14(11)26-15/h2-10H,1H3,(H,20,23)(H2,21,22,24,25) |
| InChIKey | BQJJOGYAGDYCFE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|