C17H14ClN3O2 — CID 39309484
N-[(4-chlorophenyl)methyl]-N'-(1H-indol-4-yl)oxamide (PubChem CID 39309484) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-N'-(1H-indol-4-yl)oxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-N'-(1H-indol-4-yl)oxamide |
|---|---|
| PubChem CID | 39309484 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-N'-(1H-indol-4-yl)oxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C(=O)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C17H14ClN3O2/c18-12-6-4-11(5-7-12)10-20-16(22)17(23)21-15-3-1-2-14-13(15)8-9-19-14/h1-9,19H,10H2,(H,20,22)(H,21,23) |
| InChIKey | UORLECKJUROTFY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|