C17H14F3N3O2 — CID 10066394
1-(1H-indol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 10066394) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is 1-(1H-indol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(1H-indol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 10066394 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 1-(1H-indol-4-yl)-3-[[4-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(OC(F)(F)F)cc1)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C17H14F3N3O2/c18-17(19,20)25-12-6-4-11(5-7-12)10-22-16(24)23-15-3-1-2-14-13(15)8-9-21-14/h1-9,21H,10H2,(H2,22,23,24) |
| InChIKey | VOQCVEBKIKIUCO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |