C16H14BrN3O — CID 10172203
1-[(4-bromophenyl)methyl]-3-(1H-indol-7-yl)urea (PubChem CID 10172203) has the molecular formula C16H14BrN3O and a molecular weight of 344.21 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-(1H-indol-7-yl)urea.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-(1H-indol-7-yl)urea |
|---|---|
| PubChem CID | 10172203 |
| Molecular Formula | C16H14BrN3O |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-(1H-indol-7-yl)urea |
| SMILES | O=C(NCc1ccc(Br)cc1)Nc1cccc2cc[nH]c12 |
| InChI | InChI=1S/C16H14BrN3O/c17-13-6-4-11(5-7-13)10-19-16(21)20-14-3-1-2-12-8-9-18-15(12)14/h1-9,18H,10H2,(H2,19,20,21) |
| InChIKey | GWLTVPAUAXYSAB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |