C19H17F2N3O2 — CID 167899859
1-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-(2-oxo-1H-quinolin-8-yl)urea (PubChem CID 167899859) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 1-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-(2-oxo-1H-quinolin-8-yl)urea.
| Compound Name | 1-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-(2-oxo-1H-quinolin-8-yl)urea |
|---|---|
| PubChem CID | 167899859 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-(2-oxo-1H-quinolin-8-yl)urea |
| SMILES | CC(F)(F)c1ccc(CNC(=O)Nc2cccc3ccc(=O)[nH]c23)cc1 |
| InChI | InChI=1S/C19H17F2N3O2/c1-19(20,21)14-8-5-12(6-9-14)11-22-18(26)23-15-4-2-3-13-7-10-16(25)24-17(13)15/h2-10H,11H2,1H3,(H,24,25)(H2,22,23,26) |
| InChIKey | YRAUIMHDQAHKJM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |