C17H17F3N2O — CID 3822404
1-(2,4-dimethylphenyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 3822404) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3822404 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc(C(F)(F)F)cc2)c(C)c1 |
| InChI | InChI=1S/C17H17F3N2O/c1-11-3-8-15(12(2)9-11)22-16(23)21-10-13-4-6-14(7-5-13)17(18,19)20/h3-9H,10H2,1-2H3,(H2,21,22,23) |
| InChIKey | CVCHQHYCFBUWDR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |