C17H15F3N4O — CID 22337684
1-(7-methyl-1H-indazol-4-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 22337684) has the molecular formula C17H15F3N4O and a molecular weight of 348.33 g/mol. Its IUPAC name is 1-(7-methyl-1H-indazol-4-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(7-methyl-1H-indazol-4-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 22337684 |
| Molecular Formula | C17H15F3N4O |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 1-(7-methyl-1H-indazol-4-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | Cc1ccc(NC(=O)NCc2ccc(C(F)(F)F)cc2)c2cn[nH]c12 |
| InChI | InChI=1S/C17H15F3N4O/c1-10-2-7-14(13-9-22-24-15(10)13)23-16(25)21-8-11-3-5-12(6-4-11)17(18,19)20/h2-7,9H,8H2,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | UXPZXPONKINKIE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |