C12H12F3N5O — CID 79530725
1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 79530725) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is 1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 79530725 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Nc1[nH]ncc1CNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H12F3N5O/c13-12(14,15)8-1-3-9(4-2-8)19-11(21)17-5-7-6-18-20-10(7)16/h1-4,6H,5H2,(H3,16,18,20)(H2,17,19,21) |
| InChIKey | BCFZHNOOLSCGGT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |