C11H12FN5O — CID 79531349
1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-(4-fluorophenyl)urea (PubChem CID 79531349) has the molecular formula C11H12FN5O and a molecular weight of 249.25 g/mol. Its IUPAC name is 1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 79531349 |
| Molecular Formula | C11H12FN5O |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-[(5-amino-1H-pyrazol-4-yl)methyl]-3-(4-fluorophenyl)urea |
| SMILES | Nc1[nH]ncc1CNC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FN5O/c12-8-1-3-9(4-2-8)16-11(18)14-5-7-6-15-17-10(7)13/h1-4,6H,5H2,(H3,13,15,17)(H2,14,16,18) |
| InChIKey | RSGFCKRSFLVYFL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |