C11H10Cl2N4O — CID 79530307
N-[(5-amino-1H-pyrazol-4-yl)methyl]-3,4-dichlorobenzamide (PubChem CID 79530307) has the molecular formula C11H10Cl2N4O and a molecular weight of 285.13 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-3,4-dichlorobenzamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 79530307 |
| Molecular Formula | C11H10Cl2N4O |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-3,4-dichlorobenzamide |
| SMILES | Nc1[nH]ncc1CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl2N4O/c12-8-2-1-6(3-9(8)13)11(18)15-4-7-5-16-17-10(7)14/h1-3,5H,4H2,(H,15,18)(H3,14,16,17) |
| InChIKey | RXKAFZZUGXOGHW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |