C7H8N6OS — CID 79531188
N-[(5-amino-1H-pyrazol-4-yl)methyl]thiadiazole-5-carboxamide (PubChem CID 79531188) has the molecular formula C7H8N6OS and a molecular weight of 224.25 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]thiadiazole-5-carboxamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 79531188 |
| Molecular Formula | C7H8N6OS |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]thiadiazole-5-carboxamide |
| SMILES | Nc1[nH]ncc1CNC(=O)c1cnns1 |
| InChI | InChI=1S/C7H8N6OS/c8-6-4(2-10-12-6)1-9-7(14)5-3-11-13-15-5/h2-3H,1H2,(H,9,14)(H3,8,10,12) |
| InChIKey | CPJASQJEHNRMGN-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |