C15H14N4O2 — CID 79530279
N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-hydroxynaphthalene-2-carboxamide (PubChem CID 79530279) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 79530279 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-1-hydroxynaphthalene-2-carboxamide |
| SMILES | Nc1[nH]ncc1CNC(=O)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C15H14N4O2/c16-14-10(8-18-19-14)7-17-15(21)12-6-5-9-3-1-2-4-11(9)13(12)20/h1-6,8,20H,7H2,(H,17,21)(H3,16,18,19) |
| InChIKey | FJLGJDJDWMLAQZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |