C10H12N4O2 — CID 79530310
N-[(5-amino-1H-pyrazol-4-yl)methyl]-3-methylfuran-2-carboxamide (PubChem CID 79530310) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is N-[(5-amino-1H-pyrazol-4-yl)methyl]-3-methylfuran-2-carboxamide.
| Compound Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 79530310 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | N-[(5-amino-1H-pyrazol-4-yl)methyl]-3-methylfuran-2-carboxamide |
| SMILES | Cc1ccoc1C(=O)NCc1cn[nH]c1N |
| InChI | InChI=1S/C10H12N4O2/c1-6-2-3-16-8(6)10(15)12-4-7-5-13-14-9(7)11/h2-3,5H,4H2,1H3,(H,12,15)(H3,11,13,14) |
| InChIKey | ZJKIEULLLVNWNE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |