C16H12F3N3OS — CID 11371577
1-(1,3-benzothiazol-7-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 11371577) has the molecular formula C16H12F3N3OS and a molecular weight of 351.35 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-7-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-(1,3-benzothiazol-7-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 11371577 |
| Molecular Formula | C16H12F3N3OS |
| Molecular Weight | 351.35 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-(1,3-benzothiazol-7-yl)-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(C(F)(F)F)cc1)Nc1cccc2ncsc12 |
| InChI | InChI=1S/C16H12F3N3OS/c17-16(18,19)11-6-4-10(5-7-11)8-20-15(23)22-13-3-1-2-12-14(13)24-9-21-12/h1-7,9H,8H2,(H2,20,22,23) |
| InChIKey | VWTCLFQQYGVGNJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |