C26H33N7O2 — CID 67460141
4-(aminomethyl)-N,N-dimethylaniline;1-[[4-(dimethylamino)phenyl]methyl]-3-(2-oxo-1,3-dihydrobenzimidazol-4-yl)urea (PubChem CID 67460141) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is 4-(aminomethyl)-N,N-dimethylaniline;1-[[4-(dimethylamino)phenyl]methyl]-3-(2-oxo-1,3-dihydrobenzimidazol-4-yl)urea.
| Compound Name | 4-(aminomethyl)-N,N-dimethylaniline;1-[[4-(dimethylamino)phenyl]methyl]-3-(2-oxo-1,3-dihydrobenzimidazol-4-yl)urea |
|---|---|
| PubChem CID | 67460141 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | 4-(aminomethyl)-N,N-dimethylaniline;1-[[4-(dimethylamino)phenyl]methyl]-3-(2-oxo-1,3-dihydrobenzimidazol-4-yl)urea |
| SMILES | CN(C)c1ccc(CN)cc1.CN(C)c1ccc(CNC(=O)Nc2cccc3[nH]c(=O)[nH]c23)cc1 |
| InChI | InChI=1S/C17H19N5O2.C9H14N2/c1-22(2)12-8-6-11(7-9-12)10-18-16(23)19-13-4-3-5-14-15(13)21-17(24)20-14;1-11(2)9-5-3-8(7-10)4-6-9/h3-9H,10H2,1-2H3,(H2,18,19,23)(H2,20,21,24);3-6H,7,10H2,1-2H3 |
| InChIKey | WZNHKKAIBCADTA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 122.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|