C14H11BrF2N2O — CID 108899456
1-[(4-bromophenyl)methyl]-3-(2,6-difluorophenyl)urea (PubChem CID 108899456) has the molecular formula C14H11BrF2N2O and a molecular weight of 341.16 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-(2,6-difluorophenyl)urea.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-(2,6-difluorophenyl)urea |
|---|---|
| PubChem CID | 108899456 |
| Molecular Formula | C14H11BrF2N2O |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-(2,6-difluorophenyl)urea |
| SMILES | O=C(NCc1ccc(Br)cc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C14H11BrF2N2O/c15-10-6-4-9(5-7-10)8-18-14(20)19-13-11(16)2-1-3-12(13)17/h1-7H,8H2,(H2,18,19,20) |
| InChIKey | AOFKTUBNGDFYLB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |