C16H17N5O3 — CID 120859710
5-[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 120859710) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 120859710 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 5-[4-[3-(1-aminocyclobutyl)-1,2,4-oxadiazol-5-yl]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(-c3nc(C4(N)CCC4)no3)cc2)NC(=O)NC1=O |
| InChI | InChI=1S/C16H17N5O3/c1-15(13(22)19-14(23)20-15)10-5-3-9(4-6-10)11-18-12(21-24-11)16(17)7-2-8-16/h3-6H,2,7-8,17H2,1H3,(H2,19,20,22,23) |
| InChIKey | JYXZZASQBUPPFM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|