C13H14N2O3 — CID 177135048
4-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol (PubChem CID 177135048) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 4-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol.
| Compound Name | 4-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol |
|---|---|
| PubChem CID | 177135048 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 4-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]phenol |
| SMILES | Oc1ccc(-c2noc(CC3CCOC3)n2)cc1 |
| InChI | InChI=1S/C13H14N2O3/c16-11-3-1-10(2-4-11)13-14-12(18-15-13)7-9-5-6-17-8-9/h1-4,9,16H,5-8H2 |
| InChIKey | DHYIMGMOIHXPBN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |