C9H14N2O2 — CID 131182892
3-ethyl-5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazole (PubChem CID 131182892) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-ethyl-5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 131182892 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3-ethyl-5-[[(3R)-oxolan-3-yl]methyl]-1,2,4-oxadiazole |
| SMILES | CCc1noc(C[C@H]2CCOC2)n1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-8-10-9(13-11-8)5-7-3-4-12-6-7/h7H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | UCBVTOWGDMGZSF-SSDOTTSWSA-N |
| XLogP | 1.21 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |