C9H14N2O3 — CID 115077254
1-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]ethanol (PubChem CID 115077254) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]ethanol.
| Compound Name | 1-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]ethanol |
|---|---|
| PubChem CID | 115077254 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 1-[5-(oxolan-3-ylmethyl)-1,2,4-oxadiazol-3-yl]ethanol |
| SMILES | CC(O)c1noc(CC2CCOC2)n1 |
| InChI | InChI=1S/C9H14N2O3/c1-6(12)9-10-8(14-11-9)4-7-2-3-13-5-7/h6-7,12H,2-5H2,1H3 |
| InChIKey | HSZRKQCOIYGMOX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |