C11H17NO3 — CID 115082297
1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-ol (PubChem CID 115082297) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-ol.
| Compound Name | 1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 115082297 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1-[2-(oxolan-3-ylmethyl)-1,3-oxazol-4-yl]propan-2-ol |
| SMILES | CC(O)Cc1coc(CC2CCOC2)n1 |
| InChI | InChI=1S/C11H17NO3/c1-8(13)4-10-7-15-11(12-10)5-9-2-3-14-6-9/h7-9,13H,2-6H2,1H3 |
| InChIKey | QXNHESSANMDJSC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |