C9H11NO4 — CID 115082408
2-(oxolan-3-ylmethyl)-1,3-oxazole-4-carboxylic acid (PubChem CID 115082408) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-(oxolan-3-ylmethyl)-1,3-oxazole-4-carboxylic acid.
| Compound Name | 2-(oxolan-3-ylmethyl)-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 115082408 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-(oxolan-3-ylmethyl)-1,3-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1coc(CC2CCOC2)n1 |
| InChI | InChI=1S/C9H11NO4/c11-9(12)7-5-14-8(10-7)3-6-1-2-13-4-6/h5-6H,1-4H2,(H,11,12) |
| InChIKey | BEXZDAFBCKPBCC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |