About 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid
2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid (PubChem CID 115083491) has the molecular formula C10H13NO5S
and a molecular weight of 259.28 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid.
Analyze 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid?
The IUPAC name of 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid (CID 115083491) is 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid.
What is the SMILES notation for 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid?
The canonical SMILES for 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid is O=C(O)c1coc(CC2CCCS(=O)(=O)C2)n1.
What is the InChIKey of 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid?
The InChIKey is RWCQQWKVYANXCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO5S/c12-10(13)8-5-16-9(11-8)4-7-2-1-3-17(14,15)6-7/h5,7H,1-4,6H2,(H,12,13).
What are the key properties of 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid?
2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid has a molecular weight of 259.28 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,1-dioxothian-3-yl)methyl]-1,3-oxazole-4-carboxylic acid is sourced from PubChem (CID 115083491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).