C10H14N2O4S — CID 115092859
5-[(1,1-dioxothian-3-yl)methyl]-1H-pyrazole-3-carboxylic acid (PubChem CID 115092859) has the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. Its IUPAC name is 5-[(1,1-dioxothian-3-yl)methyl]-1H-pyrazole-3-carboxylic acid.
| Compound Name | 5-[(1,1-dioxothian-3-yl)methyl]-1H-pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 115092859 |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-[(1,1-dioxothian-3-yl)methyl]-1H-pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(CC2CCCS(=O)(=O)C2)[nH]n1 |
| InChI | InChI=1S/C10H14N2O4S/c13-10(14)9-5-8(11-12-9)4-7-2-1-3-17(15,16)6-7/h5,7H,1-4,6H2,(H,11,12)(H,13,14) |
| InChIKey | MQIAJIRXUOSOMM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |